C21H20N2O4 — CID 57412269
(4aR,5aR,8aS,13aS,15aS,15bR)-5a-hydroxy-4a,5,8,13a,15,15a,15b,16-octahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-7,14-dione (PubChem CID 57412269) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (4aR,5aR,8aS,13aS,15aS,15bR)-5a-hydroxy-4a,5,8,13a,15,15a,15b,16-octahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-7,14-dione.
| Compound Name | (4aR,5aR,8aS,13aS,15aS,15bR)-5a-hydroxy-4a,5,8,13a,15,15a,15b,16-octahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-7,14-dione |
|---|---|
| PubChem CID | 57412269 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (4aR,5aR,8aS,13aS,15aS,15bR)-5a-hydroxy-4a,5,8,13a,15,15a,15b,16-octahydro-2H-4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinoline-7,14-dione |
| SMILES | O=C1C[C@@H]2OCC=C3CN4C(=O)C[C@]56c7ccccc7N1[C@H]5[C@H]2[C@H]3C[C@]46O |
| InChI | InChI=1S/C21H20N2O4/c24-16-7-15-18-12-8-21(26)20(9-17(25)22(21)10-11(12)5-6-27-15)13-3-1-2-4-14(13)23(16)19(18)20/h1-5,12,15,18-19,26H,6-10H2/t12-,15-,18-,19-,20-,21+/m0/s1 |
| InChIKey | CBNUTWOIYIEZGH-PMTQKSLQSA-N |
| XLogP | 0.94 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|