C17H25N3O4S — CID 57412618
S-[6-[(2,6-diacetamido-4-pyridinyl)oxy]hexyl] ethanethioate (PubChem CID 57412618) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is S-[6-[(2,6-diacetamido-4-pyridinyl)oxy]hexyl] ethanethioate.
| Compound Name | S-[6-[(2,6-diacetamido-4-pyridinyl)oxy]hexyl] ethanethioate |
|---|---|
| PubChem CID | 57412618 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | S-[6-[(2,6-diacetamido-4-pyridinyl)oxy]hexyl] ethanethioate |
| SMILES | CC(=O)Nc1cc(OCCCCCCSC(C)=O)cc(NC(C)=O)n1 |
| InChI | InChI=1S/C17H25N3O4S/c1-12(21)18-16-10-15(11-17(20-16)19-13(2)22)24-8-6-4-5-7-9-25-14(3)23/h10-11H,4-9H2,1-3H3,(H2,18,19,20,21,22) |
| InChIKey | DIRIBJFZQPJTIF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|