C14H19Cl2N3O — CID 57412746
3-cyclohexyl-N'-(3,5-dichloro-4-pyridinyl)propanehydrazide (PubChem CID 57412746) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is 3-cyclohexyl-N'-(3,5-dichloro-4-pyridinyl)propanehydrazide.
| Compound Name | 3-cyclohexyl-N'-(3,5-dichloro-4-pyridinyl)propanehydrazide |
|---|---|
| PubChem CID | 57412746 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-cyclohexyl-N'-(3,5-dichloro-4-pyridinyl)propanehydrazide |
| SMILES | O=C(CCC1CCCCC1)NNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O/c15-11-8-17-9-12(16)14(11)19-18-13(20)7-6-10-4-2-1-3-5-10/h8-10H,1-7H2,(H,17,19)(H,18,20) |
| InChIKey | RLBAFTRGONSHOF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|