C11H20N2OS2 — CID 57393620
methyl N-(3-cyclohexylpropanoylamino)carbamodithioate (PubChem CID 57393620) has the molecular formula C11H20N2OS2 and a molecular weight of 260.43 g/mol. Its IUPAC name is methyl N-(3-cyclohexylpropanoylamino)carbamodithioate.
| Compound Name | methyl N-(3-cyclohexylpropanoylamino)carbamodithioate |
|---|---|
| PubChem CID | 57393620 |
| Molecular Formula | C11H20N2OS2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | methyl N-(3-cyclohexylpropanoylamino)carbamodithioate |
| SMILES | CSC(=S)NNC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C11H20N2OS2/c1-16-11(15)13-12-10(14)8-7-9-5-3-2-4-6-9/h9H,2-8H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | BKDGKEIVQRZVKZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|