C10H19N3OS — CID 65214782
(3-cyclohexylpropanoylamino)thiourea (PubChem CID 65214782) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is (3-cyclohexylpropanoylamino)thiourea.
| Compound Name | (3-cyclohexylpropanoylamino)thiourea |
|---|---|
| PubChem CID | 65214782 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | (3-cyclohexylpropanoylamino)thiourea |
| SMILES | NC(=S)NNC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C10H19N3OS/c11-10(15)13-12-9(14)7-6-8-4-2-1-3-5-8/h8H,1-7H2,(H,12,14)(H3,11,13,15) |
| InChIKey | XXERCZDDABESML-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|