C12H21N3O3 — CID 47149965
2-(3-cyclohexylpropanoylamino)propanediamide (PubChem CID 47149965) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-(3-cyclohexylpropanoylamino)propanediamide.
| Compound Name | 2-(3-cyclohexylpropanoylamino)propanediamide |
|---|---|
| PubChem CID | 47149965 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-(3-cyclohexylpropanoylamino)propanediamide |
| SMILES | NC(=O)C(NC(=O)CCC1CCCCC1)C(N)=O |
| InChI | InChI=1S/C12H21N3O3/c13-11(17)10(12(14)18)15-9(16)7-6-8-4-2-1-3-5-8/h8,10H,1-7H2,(H2,13,17)(H2,14,18)(H,15,16) |
| InChIKey | FQJJTBXFRWVSLW-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|