C11H18Cl3NO2 — CID 73254061
3-cyclohexyl-N-(2,2,2-trichloro-1-hydroxyethyl)propanamide (PubChem CID 73254061) has the molecular formula C11H18Cl3NO2 and a molecular weight of 302.63 g/mol. Its IUPAC name is 3-cyclohexyl-N-(2,2,2-trichloro-1-hydroxyethyl)propanamide.
| Compound Name | 3-cyclohexyl-N-(2,2,2-trichloro-1-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 73254061 |
| Molecular Formula | C11H18Cl3NO2 |
| Molecular Weight | 302.63 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-cyclohexyl-N-(2,2,2-trichloro-1-hydroxyethyl)propanamide |
| SMILES | O=C(CCC1CCCCC1)NC(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H18Cl3NO2/c12-11(13,14)10(17)15-9(16)7-6-8-4-2-1-3-5-8/h8,10,17H,1-7H2,(H,15,16) |
| InChIKey | UGYFKBKGRXSYAV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.63 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|