C18H28N2O4 — CID 124713566
(1S,2R,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 124713566) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 124713566 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (1S,2R,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]bicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(CCC1CCCCC1)NNC(=O)[C@@H]1[C@H]2CC[C@@H](C2)[C@H]1C(=O)O |
| InChI | InChI=1S/C18H28N2O4/c21-14(9-6-11-4-2-1-3-5-11)19-20-17(22)15-12-7-8-13(10-12)16(15)18(23)24/h11-13,15-16H,1-10H2,(H,19,21)(H,20,22)(H,23,24)/t12-,13-,15+,16+/m0/s1 |
| InChIKey | FTTSTKILMGSBSU-WMHQRMGPSA-N |
| XLogP | 2.24 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|