C21H31N2O4- — CID 11916590
(1R,2S,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 11916590) has the molecular formula C21H31N2O4- and a molecular weight of 375.49 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | (1R,2S,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 11916590 |
| Molecular Formula | C21H31N2O4- |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (1R,2S,3R,4S)-3-[(3-cyclohexylpropanoylamino)carbamoyl]-7-propan-2-ylidenebicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C)=C1[C@H]2CC[C@@H]1[C@H](C(=O)[O-])[C@@H]2C(=O)NNC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C21H32N2O4/c1-12(2)17-14-9-10-15(17)19(21(26)27)18(14)20(25)23-22-16(24)11-8-13-6-4-3-5-7-13/h13-15,18-19H,3-11H2,1-2H3,(H,22,24)(H,23,25)(H,26,27)/p-1/t14-,15+,18-,19+/m1/s1 |
| InChIKey | LHKHEXGCGNWVRO-OHQAAIJDSA-M |
| XLogP | 1.85 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|