C22H26F2O5 — CID 57412797
(2S,3R,4R,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol (PubChem CID 57412797) has the molecular formula C22H26F2O5 and a molecular weight of 408.44 g/mol. Its IUPAC name is (2S,3R,4R,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2S,3R,4R,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 57412797 |
| Molecular Formula | C22H26F2O5 |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (2S,3R,4R,6R)-2-[3-[(4-ethoxyphenyl)methyl]-4-methylphenyl]-5,5-difluoro-6-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CCOc1ccc(Cc2cc([C@@H]3O[C@H](CO)C(F)(F)[C@H](O)[C@H]3O)ccc2C)cc1 |
| InChI | InChI=1S/C22H26F2O5/c1-3-28-17-8-5-14(6-9-17)10-16-11-15(7-4-13(16)2)20-19(26)21(27)22(23,24)18(12-25)29-20/h4-9,11,18-21,25-27H,3,10,12H2,1-2H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | ZTTZWEOSPHUNSY-IVAOSVALSA-N |
| XLogP | 2.77 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |