C31H33F3N2O5 — CID 57414972
2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-N-(oxan-4-ylmethyl)acetamide (PubChem CID 57414972) has the molecular formula C31H33F3N2O5 and a molecular weight of 570.61 g/mol. Its IUPAC name is 2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-N-(oxan-4-ylmethyl)acetamide.
| Compound Name | 2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-N-(oxan-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 57414972 |
| Molecular Formula | C31H33F3N2O5 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 2-[4-[(E)-C-benzyl-N-[[4-(trifluoromethoxy)phenyl]methoxy]carbonimidoyl]-2-methylphenoxy]-N-(oxan-4-ylmethyl)acetamide |
| SMILES | Cc1cc(/C(Cc2ccccc2)=N/OCc2ccc(OC(F)(F)F)cc2)ccc1OCC(=O)NCC1CCOCC1 |
| InChI | InChI=1S/C31H33F3N2O5/c1-22-17-26(9-12-29(22)39-21-30(37)35-19-24-13-15-38-16-14-24)28(18-23-5-3-2-4-6-23)36-40-20-25-7-10-27(11-8-25)41-31(32,33)34/h2-12,17,24H,13-16,18-21H2,1H3,(H,35,37)/b36-28+ |
| InChIKey | GNALAPQNUGCQQR-FDEZRRJOSA-N |
| XLogP | 5.98 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|