About indolizin-2-ol
indolizin-2-ol (PubChem CID 57421632) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is indolizin-2-ol.
Molecular Properties
| Compound Name | indolizin-2-ol |
| PubChem CID | 57421632 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | indolizin-2-ol |
| SMILES | Oc1cc2ccccn2c1 |
| InChI | InChI=1S/C8H7NO/c10-8-5-7-3-1-2-4-9(7)6-8/h1-6,10H |
| InChIKey | PUDOKERBWCVTIK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indolizin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizin-2-ol?
The IUPAC name of indolizin-2-ol (CID 57421632) is indolizin-2-ol.
What is the SMILES notation for indolizin-2-ol?
The canonical SMILES for indolizin-2-ol is Oc1cc2ccccn2c1.
What is the InChIKey of indolizin-2-ol?
The InChIKey is PUDOKERBWCVTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO/c10-8-5-7-3-1-2-4-9(7)6-8/h1-6,10H.
What are the key properties of indolizin-2-ol?
indolizin-2-ol has a molecular weight of 133.15 g/mol, XLogP of 1.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indolizin-2-ol is sourced from PubChem (CID 57421632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).