About 2-(sulfinoamino)decane
2-(sulfinoamino)decane (PubChem CID 57421744) has the molecular formula C10H23NO2S
and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-(sulfinoamino)decane.
Molecular Properties
| Compound Name | 2-(sulfinoamino)decane |
| PubChem CID | 57421744 |
| Molecular Formula | C10H23NO2S |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(sulfinoamino)decane |
| SMILES | CCCCCCCCC(C)NS(=O)O |
| InChI | InChI=1S/C10H23NO2S/c1-3-4-5-6-7-8-9-10(2)11-14(12)13/h10-11H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | CPTKEZDVROPMGV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(sulfinoamino)decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(sulfinoamino)decane?
The IUPAC name of 2-(sulfinoamino)decane (CID 57421744) is 2-(sulfinoamino)decane.
What is the SMILES notation for 2-(sulfinoamino)decane?
The canonical SMILES for 2-(sulfinoamino)decane is CCCCCCCCC(C)NS(=O)O.
What is the InChIKey of 2-(sulfinoamino)decane?
The InChIKey is CPTKEZDVROPMGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO2S/c1-3-4-5-6-7-8-9-10(2)11-14(12)13/h10-11H,3-9H2,1-2H3,(H,12,13).
What are the key properties of 2-(sulfinoamino)decane?
2-(sulfinoamino)decane has a molecular weight of 221.37 g/mol, XLogP of 2.85, 9 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(sulfinoamino)decane is sourced from PubChem (CID 57421744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).