C11H7Cl2FN2S — CID 57427822
2,4-dichloro-6-[(4-fluorophenyl)sulfanylmethyl]pyrimidine (PubChem CID 57427822) has the molecular formula C11H7Cl2FN2S and a molecular weight of 289.16 g/mol. Its IUPAC name is 2,4-dichloro-6-[(4-fluorophenyl)sulfanylmethyl]pyrimidine.
| Compound Name | 2,4-dichloro-6-[(4-fluorophenyl)sulfanylmethyl]pyrimidine |
|---|---|
| PubChem CID | 57427822 |
| Molecular Formula | C11H7Cl2FN2S |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | 2,4-dichloro-6-[(4-fluorophenyl)sulfanylmethyl]pyrimidine |
| SMILES | Fc1ccc(SCc2cc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C11H7Cl2FN2S/c12-10-5-8(15-11(13)16-10)6-17-9-3-1-7(14)2-4-9/h1-5H,6H2 |
| InChIKey | UHEXBGUZZFSXPV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |