C12H13N3O — CID 57433379
(3-aminophenyl)-(1,3-dimethylpyrazol-4-yl)methanone (PubChem CID 57433379) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is (3-aminophenyl)-(1,3-dimethylpyrazol-4-yl)methanone.
| Compound Name | (3-aminophenyl)-(1,3-dimethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 57433379 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (3-aminophenyl)-(1,3-dimethylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(C)cc1C(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C12H13N3O/c1-8-11(7-15(2)14-8)12(16)9-4-3-5-10(13)6-9/h3-7H,13H2,1-2H3 |
| InChIKey | XCJMRDDECHBZQP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|