C31H35N5O2 — CID 57437128
[4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-[(prop-2-enylamino)methyl]phenyl]methyl acetate (PubChem CID 57437128) has the molecular formula C31H35N5O2 and a molecular weight of 509.65 g/mol. Its IUPAC name is [4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-[(prop-2-enylamino)methyl]phenyl]methyl acetate.
| Compound Name | [4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-[(prop-2-enylamino)methyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 57437128 |
| Molecular Formula | C31H35N5O2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | [4-[[1H-benzimidazol-2-ylmethyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-3-[(prop-2-enylamino)methyl]phenyl]methyl acetate |
| SMILES | C=CCNCc1cc(COC(C)=O)ccc1CN(Cc1nc2ccccc2[nH]1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C31H35N5O2/c1-3-15-32-18-26-17-23(21-38-22(2)37)13-14-25(26)19-36(20-30-34-27-10-4-5-11-28(27)35-30)29-12-6-8-24-9-7-16-33-31(24)29/h3-5,7,9-11,13-14,16-17,29,32H,1,6,8,12,15,18-21H2,2H3,(H,34,35) |
| InChIKey | APYLQNPYNBHZFF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|