C20H18INO2 — CID 57439842
2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-7-iodofluoren-9-one (PubChem CID 57439842) has the molecular formula C20H18INO2 and a molecular weight of 431.27 g/mol. Its IUPAC name is 2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-7-iodofluoren-9-one.
| Compound Name | 2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-7-iodofluoren-9-one |
|---|---|
| PubChem CID | 57439842 |
| Molecular Formula | C20H18INO2 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 2-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]-7-iodofluoren-9-one |
| SMILES | O=C1c2cc(I)ccc2-c2ccc(O[C@H]3CN4CCC3CC4)cc21 |
| InChI | InChI=1S/C20H18INO2/c21-13-1-3-15-16-4-2-14(10-18(16)20(23)17(15)9-13)24-19-11-22-7-5-12(19)6-8-22/h1-4,9-10,12,19H,5-8,11H2/t19-/m0/s1 |
| InChIKey | RSMYAWRMYPHDGL-IBGZPJMESA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|