C24H27N3O4S2 — CID 57443892
N-[[5-(4-anilinopiperidin-1-yl)sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide (PubChem CID 57443892) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-[[5-(4-anilinopiperidin-1-yl)sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide.
| Compound Name | N-[[5-(4-anilinopiperidin-1-yl)sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 57443892 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-[[5-(4-anilinopiperidin-1-yl)sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCc2ccc(S(=O)(=O)N3CCC(Nc4ccccc4)CC3)s2)c1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-31-21-9-5-6-18(16-21)24(28)25-17-22-10-11-23(32-22)33(29,30)27-14-12-20(13-15-27)26-19-7-3-2-4-8-19/h2-11,16,20,26H,12-15,17H2,1H3,(H,25,28) |
| InChIKey | MWSITTVZPOTQRK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |