C24H35N3O4S2 — CID 10185063
3-methoxy-N-[[5-[4-(pentylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 10185063) has the molecular formula C24H35N3O4S2 and a molecular weight of 493.70 g/mol. Its IUPAC name is 3-methoxy-N-[[5-[4-(pentylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 3-methoxy-N-[[5-[4-(pentylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10185063 |
| Molecular Formula | C24H35N3O4S2 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | 3-methoxy-N-[[5-[4-(pentylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | CCCCCNC1CCCN(S(=O)(=O)c2ccc(CNC(=O)c3cccc(OC)c3)s2)CC1 |
| InChI | InChI=1S/C24H35N3O4S2/c1-3-4-5-14-25-20-9-7-15-27(16-13-20)33(29,30)23-12-11-22(32-23)18-26-24(28)19-8-6-10-21(17-19)31-2/h6,8,10-12,17,20,25H,3-5,7,9,13-16,18H2,1-2H3,(H,26,28) |
| InChIKey | YWQNBWKSGSHTSA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|