C25H37N3O6S2 — CID 10143590
N-[[5-[4-(3,3-diethoxypropylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide (PubChem CID 10143590) has the molecular formula C25H37N3O6S2 and a molecular weight of 539.72 g/mol. Its IUPAC name is N-[[5-[4-(3,3-diethoxypropylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide.
| Compound Name | N-[[5-[4-(3,3-diethoxypropylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 10143590 |
| Molecular Formula | C25H37N3O6S2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | N-[[5-[4-(3,3-diethoxypropylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-methoxybenzamide |
| SMILES | CCOC(CCNC1CCN(S(=O)(=O)c2ccc(CNC(=O)c3cccc(OC)c3)s2)CC1)OCC |
| InChI | InChI=1S/C25H37N3O6S2/c1-4-33-23(34-5-2)11-14-26-20-12-15-28(16-13-20)36(30,31)24-10-9-22(35-24)18-27-25(29)19-7-6-8-21(17-19)32-3/h6-10,17,20,23,26H,4-5,11-16,18H2,1-3H3,(H,27,29) |
| InChIKey | CKXLOOSPQMRJMK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|