C26H38N4O5S2 — CID 10143969
3-methoxy-N-[[5-[4-(3-morpholin-4-ylpropylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 10143969) has the molecular formula C26H38N4O5S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is 3-methoxy-N-[[5-[4-(3-morpholin-4-ylpropylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 3-methoxy-N-[[5-[4-(3-morpholin-4-ylpropylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10143969 |
| Molecular Formula | C26H38N4O5S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | 3-methoxy-N-[[5-[4-(3-morpholin-4-ylpropylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | COc1cccc(C(=O)NCc2ccc(S(=O)(=O)N3CCCC(NCCCN4CCOCC4)CC3)s2)c1 |
| InChI | InChI=1S/C26H38N4O5S2/c1-34-23-7-2-5-21(19-23)26(31)28-20-24-8-9-25(36-24)37(32,33)30-13-3-6-22(10-14-30)27-11-4-12-29-15-17-35-18-16-29/h2,5,7-9,19,22,27H,3-4,6,10-18,20H2,1H3,(H,28,31) |
| InChIKey | VJNFCXZOALNNPM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|