C25H36ClN3O3S2 — CID 10301851
4-chloro-N-[[5-[4-(heptylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 10301851) has the molecular formula C25H36ClN3O3S2 and a molecular weight of 526.17 g/mol. Its IUPAC name is 4-chloro-N-[[5-[4-(heptylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[4-(heptylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10301851 |
| Molecular Formula | C25H36ClN3O3S2 |
| Molecular Weight | 526.17 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 4-chloro-N-[[5-[4-(heptylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | CCCCCCCNC1CCCN(S(=O)(=O)c2ccc(CNC(=O)c3ccc(Cl)cc3)s2)CC1 |
| InChI | InChI=1S/C25H36ClN3O3S2/c1-2-3-4-5-6-16-27-22-8-7-17-29(18-15-22)34(31,32)24-14-13-23(33-24)19-28-25(30)20-9-11-21(26)12-10-20/h9-14,22,27H,2-8,15-19H2,1H3,(H,28,30) |
| InChIKey | BRLVCXYGWOZEPV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.17 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|