C23H31ClN4O3S2 — CID 69025617
acetonitrile;N-[[5-[4-(butylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide (PubChem CID 69025617) has the molecular formula C23H31ClN4O3S2 and a molecular weight of 511.11 g/mol. Its IUPAC name is acetonitrile;N-[[5-[4-(butylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide.
| Compound Name | acetonitrile;N-[[5-[4-(butylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 69025617 |
| Molecular Formula | C23H31ClN4O3S2 |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | acetonitrile;N-[[5-[4-(butylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide |
| SMILES | CC#N.CCCCNC1CCN(S(=O)(=O)c2ccc(CNC(=O)c3ccc(Cl)cc3)s2)CC1 |
| InChI | InChI=1S/C21H28ClN3O3S2.C2H3N/c1-2-3-12-23-18-10-13-25(14-11-18)30(27,28)20-9-8-19(29-20)15-24-21(26)16-4-6-17(22)7-5-16;1-2-3/h4-9,18,23H,2-3,10-15H2,1H3,(H,24,26);1H3 |
| InChIKey | WRKHWBKZMOETHY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|