C30H38ClN3O3S2 — CID 57443944
N-[[5-[4-[benzyl(hexyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide (PubChem CID 57443944) has the molecular formula C30H38ClN3O3S2 and a molecular weight of 588.24 g/mol. Its IUPAC name is N-[[5-[4-[benzyl(hexyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide.
| Compound Name | N-[[5-[4-[benzyl(hexyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 57443944 |
| Molecular Formula | C30H38ClN3O3S2 |
| Molecular Weight | 588.24 g/mol |
| Exact Mass | 587.20 |
| IUPAC Name | N-[[5-[4-[benzyl(hexyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide |
| SMILES | CCCCCCN(Cc1ccccc1)C1CCN(S(=O)(=O)c2ccc(CNC(=O)c3ccc(Cl)cc3)s2)CC1 |
| InChI | InChI=1S/C30H38ClN3O3S2/c1-2-3-4-8-19-33(23-24-9-6-5-7-10-24)27-17-20-34(21-18-27)39(36,37)29-16-15-28(38-29)22-32-30(35)25-11-13-26(31)14-12-25/h5-7,9-16,27H,2-4,8,17-23H2,1H3,(H,32,35) |
| InChIKey | QEHDHRBPLGLGSO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.24 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|