C22H32ClN3O3S2 — CID 10227995
4-chloro-N-[[5-[3-[hexyl(methyl)amino]propylsulfamoyl]thiophen-2-yl]methyl]benzamide (PubChem CID 10227995) has the molecular formula C22H32ClN3O3S2 and a molecular weight of 486.10 g/mol. Its IUPAC name is 4-chloro-N-[[5-[3-[hexyl(methyl)amino]propylsulfamoyl]thiophen-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[3-[hexyl(methyl)amino]propylsulfamoyl]thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 10227995 |
| Molecular Formula | C22H32ClN3O3S2 |
| Molecular Weight | 486.10 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4-chloro-N-[[5-[3-[hexyl(methyl)amino]propylsulfamoyl]thiophen-2-yl]methyl]benzamide |
| SMILES | CCCCCCN(C)CCCNS(=O)(=O)c1ccc(CNC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C22H32ClN3O3S2/c1-3-4-5-6-15-26(2)16-7-14-25-31(28,29)21-13-12-20(30-21)17-24-22(27)18-8-10-19(23)11-9-18/h8-13,25H,3-7,14-17H2,1-2H3,(H,24,27) |
| InChIKey | IYIOMWBHEHMAQN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.10 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|