C22H32N4O4S2 — CID 68659027
N-[[5-[4-(hexylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 68659027) has the molecular formula C22H32N4O4S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is N-[[5-[4-(hexylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[[5-[4-(hexylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68659027 |
| Molecular Formula | C22H32N4O4S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | N-[[5-[4-(hexylamino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCCCCCNC1CCN(S(=O)(=O)c2ccc(CNC(=O)c3ccc[nH]c3=O)s2)CC1 |
| InChI | InChI=1S/C22H32N4O4S2/c1-2-3-4-5-12-23-17-10-14-26(15-11-17)32(29,30)20-9-8-18(31-20)16-25-22(28)19-7-6-13-24-21(19)27/h6-9,13,17,23H,2-5,10-12,14-16H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | VTKJUWWSYDUOTP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|