C22H30ClN3O3S2 — CID 142776657
3-[[5-[4-(butylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide (PubChem CID 142776657) has the molecular formula C22H30ClN3O3S2 and a molecular weight of 484.09 g/mol. Its IUPAC name is 3-[[5-[4-(butylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide.
| Compound Name | 3-[[5-[4-(butylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 142776657 |
| Molecular Formula | C22H30ClN3O3S2 |
| Molecular Weight | 484.09 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 3-[[5-[4-(butylamino)azepan-1-yl]sulfonylthiophen-2-yl]methyl]-4-chlorobenzamide |
| SMILES | CCCCNC1CCCN(S(=O)(=O)c2ccc(Cc3cc(C(N)=O)ccc3Cl)s2)CC1 |
| InChI | InChI=1S/C22H30ClN3O3S2/c1-2-3-11-25-18-5-4-12-26(13-10-18)31(28,29)21-9-7-19(30-21)15-17-14-16(22(24)27)6-8-20(17)23/h6-9,14,18,25H,2-5,10-13,15H2,1H3,(H2,24,27) |
| InChIKey | LONAONZMMRBHQE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.09 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|