C24H26N4O6S2 — CID 57443884
3-methoxy-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 57443884) has the molecular formula C24H26N4O6S2 and a molecular weight of 530.63 g/mol. Its IUPAC name is 3-methoxy-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 3-methoxy-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 57443884 |
| Molecular Formula | C24H26N4O6S2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 3-methoxy-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | COc1cccc(C(=O)NCc2ccc(S(=O)(=O)N3CCC(Nc4cccc([N+](=O)[O-])c4)CC3)s2)c1 |
| InChI | InChI=1S/C24H26N4O6S2/c1-34-21-7-2-4-17(14-21)24(29)25-16-22-8-9-23(35-22)36(32,33)27-12-10-18(11-13-27)26-19-5-3-6-20(15-19)28(30)31/h2-9,14-15,18,26H,10-13,16H2,1H3,(H,25,29) |
| InChIKey | PVGNZTSNAGJCPB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|