C24H25N5O6S2 — CID 57443842
N-[[5-[4-(4-carbamoylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-nitrobenzamide (PubChem CID 57443842) has the molecular formula C24H25N5O6S2 and a molecular weight of 543.63 g/mol. Its IUPAC name is N-[[5-[4-(4-carbamoylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-nitrobenzamide.
| Compound Name | N-[[5-[4-(4-carbamoylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 57443842 |
| Molecular Formula | C24H25N5O6S2 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | N-[[5-[4-(4-carbamoylanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]-3-nitrobenzamide |
| SMILES | NC(=O)c1ccc(NC2CCN(S(=O)(=O)c3ccc(CNC(=O)c4cccc([N+](=O)[O-])c4)s3)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O6S2/c25-23(30)16-4-6-18(7-5-16)27-19-10-12-28(13-11-19)37(34,35)22-9-8-21(36-22)15-26-24(31)17-2-1-3-20(14-17)29(32)33/h1-9,14,19,27H,10-13,15H2,(H2,25,30)(H,26,31) |
| InChIKey | KQRCUPACJOIEGV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 164.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|