C24H22ClN5O5S2 — CID 11489846
4-chloro-N-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 11489846) has the molecular formula C24H22ClN5O5S2 and a molecular weight of 560.06 g/mol. Its IUPAC name is 4-chloro-N-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 11489846 |
| Molecular Formula | C24H22ClN5O5S2 |
| Molecular Weight | 560.06 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 4-chloro-N-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCC(n3cnc4ccc([N+](=O)[O-])cc43)CC2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN5O5S2/c25-17-3-1-16(2-4-17)24(31)26-14-20-6-8-23(36-20)37(34,35)28-11-9-18(10-12-28)29-15-27-21-7-5-19(30(32)33)13-22(21)29/h1-8,13,15,18H,9-12,14H2,(H,26,31) |
| InChIKey | XWMFUAAGQJEPSU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.06 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|