C24H23F3N4O7S3 — CID 67403728
3-nitro-N-[[5-[4-[4-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 67403728) has the molecular formula C24H23F3N4O7S3 and a molecular weight of 632.66 g/mol. Its IUPAC name is 3-nitro-N-[[5-[4-[4-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 3-nitro-N-[[5-[4-[4-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 67403728 |
| Molecular Formula | C24H23F3N4O7S3 |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.07 |
| IUPAC Name | 3-nitro-N-[[5-[4-[4-(trifluoromethylsulfonyl)anilino]piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCC(Nc3ccc(S(=O)(=O)C(F)(F)F)cc3)CC2)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23F3N4O7S3/c25-24(26,27)40(35,36)21-7-4-17(5-8-21)29-18-10-12-30(13-11-18)41(37,38)22-9-6-20(39-22)15-28-23(32)16-2-1-3-19(14-16)31(33)34/h1-9,14,18,29H,10-13,15H2,(H,28,32) |
| InChIKey | JBUBPYZXKUZEKO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|