C28H31N3O5S2 — CID 174413899
3-nitro-N-[[5-[1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-enylsulfonyl]thiophen-2-yl]methyl]benzamide (PubChem CID 174413899) has the molecular formula C28H31N3O5S2 and a molecular weight of 553.71 g/mol. Its IUPAC name is 3-nitro-N-[[5-[1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-enylsulfonyl]thiophen-2-yl]methyl]benzamide.
| Compound Name | 3-nitro-N-[[5-[1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-enylsulfonyl]thiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 174413899 |
| Molecular Formula | C28H31N3O5S2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | 3-nitro-N-[[5-[1-[4-(2-phenylethyl)piperidin-1-yl]prop-2-enylsulfonyl]thiophen-2-yl]methyl]benzamide |
| SMILES | C=CC(N1CCC(CCc2ccccc2)CC1)S(=O)(=O)c1ccc(CNC(=O)c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C28H31N3O5S2/c1-2-26(30-17-15-22(16-18-30)12-11-21-7-4-3-5-8-21)38(35,36)27-14-13-25(37-27)20-29-28(32)23-9-6-10-24(19-23)31(33)34/h2-10,13-14,19,22,26H,1,11-12,15-18,20H2,(H,29,32) |
| InChIKey | ZZKVYSFNPSVHMK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|