C29H36N4O5S2 — CID 174438508
N-[[5-[1-(4-aminopiperidin-1-yl)prop-2-enylsulfonyl]thiophen-2-yl]methyl]-3-nitrobenzamide;propylbenzene (PubChem CID 174438508) has the molecular formula C29H36N4O5S2 and a molecular weight of 584.76 g/mol. Its IUPAC name is N-[[5-[1-(4-aminopiperidin-1-yl)prop-2-enylsulfonyl]thiophen-2-yl]methyl]-3-nitrobenzamide;propylbenzene.
| Compound Name | N-[[5-[1-(4-aminopiperidin-1-yl)prop-2-enylsulfonyl]thiophen-2-yl]methyl]-3-nitrobenzamide;propylbenzene |
|---|---|
| PubChem CID | 174438508 |
| Molecular Formula | C29H36N4O5S2 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | N-[[5-[1-(4-aminopiperidin-1-yl)prop-2-enylsulfonyl]thiophen-2-yl]methyl]-3-nitrobenzamide;propylbenzene |
| SMILES | C=CC(N1CCC(N)CC1)S(=O)(=O)c1ccc(CNC(=O)c2cccc([N+](=O)[O-])c2)s1.CCCc1ccccc1 |
| InChI | InChI=1S/C20H24N4O5S2.C9H12/c1-2-18(23-10-8-15(21)9-11-23)31(28,29)19-7-6-17(30-19)13-22-20(25)14-4-3-5-16(12-14)24(26)27;1-2-6-9-7-4-3-5-8-9/h2-7,12,15,18H,1,8-11,13,21H2,(H,22,25);3-5,7-8H,2,6H2,1H3 |
| InChIKey | CWICPMUPSFVGFL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|