C23H23N5O7S2 — CID 142776647
3-nitro-2-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide (PubChem CID 142776647) has the molecular formula C23H23N5O7S2 and a molecular weight of 545.60 g/mol. Its IUPAC name is 3-nitro-2-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide.
| Compound Name | 3-nitro-2-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 142776647 |
| Molecular Formula | C23H23N5O7S2 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 3-nitro-2-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylthiophen-2-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc([N+](=O)[O-])c1Cc1ccc(S(=O)(=O)N2CCC(Nc3cccc([N+](=O)[O-])c3)CC2)s1 |
| InChI | InChI=1S/C23H23N5O7S2/c24-23(29)19-5-2-6-21(28(32)33)20(19)14-18-7-8-22(36-18)37(34,35)26-11-9-15(10-12-26)25-16-3-1-4-17(13-16)27(30)31/h1-8,13,15,25H,9-12,14H2,(H2,24,29) |
| InChIKey | CQEHIFNZGJRIIZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|