C23H23ClN4O6S — CID 57443919
4-chloro-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide (PubChem CID 57443919) has the molecular formula C23H23ClN4O6S and a molecular weight of 518.98 g/mol. Its IUPAC name is 4-chloro-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 57443919 |
| Molecular Formula | C23H23ClN4O6S |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 4-chloro-N-[[5-[4-(3-nitroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCC(Nc3cccc([N+](=O)[O-])c3)CC2)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN4O6S/c24-17-6-4-16(5-7-17)23(29)25-15-21-8-9-22(34-21)35(32,33)27-12-10-18(11-13-27)26-19-2-1-3-20(14-19)28(30)31/h1-9,14,18,26H,10-13,15H2,(H,25,29) |
| InChIKey | YQJXSQHEVFPNAC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|