C23H23Cl2N3O4S — CID 57443922
4-chloro-N-[[5-[4-(4-chloroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide (PubChem CID 57443922) has the molecular formula C23H23Cl2N3O4S and a molecular weight of 508.43 g/mol. Its IUPAC name is 4-chloro-N-[[5-[4-(4-chloroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide.
| Compound Name | 4-chloro-N-[[5-[4-(4-chloroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 57443922 |
| Molecular Formula | C23H23Cl2N3O4S |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 4-chloro-N-[[5-[4-(4-chloroanilino)piperidin-1-yl]sulfonylfuran-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCC(Nc3ccc(Cl)cc3)CC2)o1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23Cl2N3O4S/c24-17-3-1-16(2-4-17)23(29)26-15-21-9-10-22(32-21)33(30,31)28-13-11-20(12-14-28)27-19-7-5-18(25)6-8-19/h1-10,20,27H,11-15H2,(H,26,29) |
| InChIKey | XVUHXWCAMOYWOY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |