C24H22N7O8S2+ — CID 175247307
[5-[4-[(3-nitrobenzoyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methylimino-(3-nitrobenzoyl)iminoazanium (PubChem CID 175247307) has the molecular formula C24H22N7O8S2+ and a molecular weight of 600.62 g/mol. Its IUPAC name is [5-[4-[(3-nitrobenzoyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methylimino-(3-nitrobenzoyl)iminoazanium.
| Compound Name | [5-[4-[(3-nitrobenzoyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methylimino-(3-nitrobenzoyl)iminoazanium |
|---|---|
| PubChem CID | 175247307 |
| Molecular Formula | C24H22N7O8S2+ |
| Molecular Weight | 600.62 g/mol |
| Exact Mass | 600.10 |
| IUPAC Name | [5-[4-[(3-nitrobenzoyl)amino]piperidin-1-yl]sulfonylthiophen-2-yl]methylimino-(3-nitrobenzoyl)iminoazanium |
| SMILES | O=C(N=[N+]=NCc1ccc(S(=O)(=O)N2CCC(NC(=O)c3cccc([N+](=O)[O-])c3)CC2)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H21N7O8S2/c32-23(16-3-1-5-19(13-16)30(34)35)26-18-9-11-29(12-10-18)41(38,39)22-8-7-21(40-22)15-25-28-27-24(33)17-4-2-6-20(14-17)31(36)37/h1-8,13-14,18H,9-12,15H2/p+1 |
| InChIKey | JHDFYZJTWNRCAW-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 208.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.62 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|