C24H21ClN7O5S2+ — CID 174521330
(4-chlorobenzoyl)imino-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium (PubChem CID 174521330) has the molecular formula C24H21ClN7O5S2+ and a molecular weight of 587.06 g/mol. Its IUPAC name is (4-chlorobenzoyl)imino-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium.
| Compound Name | (4-chlorobenzoyl)imino-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium |
|---|---|
| PubChem CID | 174521330 |
| Molecular Formula | C24H21ClN7O5S2+ |
| Molecular Weight | 587.06 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | (4-chlorobenzoyl)imino-[[5-[4-(6-nitrobenzimidazol-1-yl)piperidin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium |
| SMILES | O=C(N=[N+]=NCc1ccc(S(=O)(=O)N2CCC(n3cnc4ccc([N+](=O)[O-])cc43)CC2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClN7O5S2/c25-17-3-1-16(2-4-17)24(33)28-29-27-14-20-6-8-23(38-20)39(36,37)30-11-9-18(10-12-30)31-15-26-21-7-5-19(32(34)35)13-22(21)31/h1-8,13,15,18H,9-12,14H2/q+1 |
| InChIKey | XKYQQUWUAMNUGQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 154.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.06 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|