C23H22ClFN5O3S2+ — CID 174521331
(4-chlorobenzoyl)imino-[[5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium (PubChem CID 174521331) has the molecular formula C23H22ClFN5O3S2+ and a molecular weight of 535.05 g/mol. Its IUPAC name is (4-chlorobenzoyl)imino-[[5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium.
| Compound Name | (4-chlorobenzoyl)imino-[[5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium |
|---|---|
| PubChem CID | 174521331 |
| Molecular Formula | C23H22ClFN5O3S2+ |
| Molecular Weight | 535.05 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | (4-chlorobenzoyl)imino-[[5-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]sulfonylthiophen-2-yl]methylimino]azanium |
| SMILES | O=C(N=[N+]=NCc1ccc(S(=O)(=O)N2CCN(Cc3ccc(F)cc3)CC2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H22ClFN5O3S2/c24-19-5-3-18(4-6-19)23(31)27-28-26-15-21-9-10-22(34-21)35(32,33)30-13-11-29(12-14-30)16-17-1-7-20(25)8-2-17/h1-10H,11-16H2/q+1 |
| InChIKey | FADXZTKUPYETMO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.05 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|