C15H15ClFN3 — CID 57444194
4-chloro-5-[(3-fluorophenyl)methyl]-6-pyrrolidin-1-ylpyrimidine (PubChem CID 57444194) has the molecular formula C15H15ClFN3 and a molecular weight of 291.76 g/mol. Its IUPAC name is 4-chloro-5-[(3-fluorophenyl)methyl]-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 4-chloro-5-[(3-fluorophenyl)methyl]-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 57444194 |
| Molecular Formula | C15H15ClFN3 |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-chloro-5-[(3-fluorophenyl)methyl]-6-pyrrolidin-1-ylpyrimidine |
| SMILES | Fc1cccc(Cc2c(Cl)ncnc2N2CCCC2)c1 |
| InChI | InChI=1S/C15H15ClFN3/c16-14-13(9-11-4-3-5-12(17)8-11)15(19-10-18-14)20-6-1-2-7-20/h3-5,8,10H,1-2,6-7,9H2 |
| InChIKey | SWIHAPKDDCEGCC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |