C23H17F4NO5 — CID 57453392
2-[(E)-[2,3-bis[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid (PubChem CID 57453392) has the molecular formula C23H17F4NO5 and a molecular weight of 463.38 g/mol. Its IUPAC name is 2-[(E)-[2,3-bis[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[2,3-bis[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 57453392 |
| Molecular Formula | C23H17F4NO5 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.10 |
| IUPAC Name | 2-[(E)-[2,3-bis[(3,4-difluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CO/N=C/c1cccc(OCc2ccc(F)c(F)c2)c1OCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C23H17F4NO5/c24-17-6-4-14(8-19(17)26)11-31-21-3-1-2-16(10-28-33-13-22(29)30)23(21)32-12-15-5-7-18(25)20(27)9-15/h1-10H,11-13H2,(H,29,30)/b28-10+ |
| InChIKey | QAPBILONZLMEOX-ORBVJSQLSA-N |
| XLogP | 4.84 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|