C23H19F2NO5 — CID 57453394
2-[(E)-[3,5-bis[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid (PubChem CID 57453394) has the molecular formula C23H19F2NO5 and a molecular weight of 427.40 g/mol. Its IUPAC name is 2-[(E)-[3,5-bis[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[3,5-bis[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 57453394 |
| Molecular Formula | C23H19F2NO5 |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-[(E)-[3,5-bis[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CO/N=C/c1cc(OCc2ccc(F)cc2)cc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H19F2NO5/c24-19-5-1-16(2-6-19)13-29-21-9-18(12-26-31-15-23(27)28)10-22(11-21)30-14-17-3-7-20(25)8-4-17/h1-12H,13-15H2,(H,27,28)/b26-12+ |
| InChIKey | FZCRWQZJMVKLFD-RPPGKUMJSA-N |
| XLogP | 4.56 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|