C29H23Br2NO5 — CID 11422226
2-[(E)-[3-[2,4-bis[(4-bromophenyl)methoxy]phenyl]phenyl]methylideneamino]oxyacetic acid (PubChem CID 11422226) has the molecular formula C29H23Br2NO5 and a molecular weight of 625.31 g/mol. Its IUPAC name is 2-[(E)-[3-[2,4-bis[(4-bromophenyl)methoxy]phenyl]phenyl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-[3-[2,4-bis[(4-bromophenyl)methoxy]phenyl]phenyl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 11422226 |
| Molecular Formula | C29H23Br2NO5 |
| Molecular Weight | 625.31 g/mol |
| Exact Mass | 622.99 |
| IUPAC Name | 2-[(E)-[3-[2,4-bis[(4-bromophenyl)methoxy]phenyl]phenyl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CO/N=C/c1cccc(-c2ccc(OCc3ccc(Br)cc3)cc2OCc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C29H23Br2NO5/c30-24-8-4-20(5-9-24)17-35-26-12-13-27(28(15-26)36-18-21-6-10-25(31)11-7-21)23-3-1-2-22(14-23)16-32-37-19-29(33)34/h1-16H,17-19H2,(H,33,34)/b32-16+ |
| InChIKey | RLENDCGYFDPCLE-KPGMTVGESA-N |
| XLogP | 7.47 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.31 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|