C26H21NO4 — CID 91326292
2-[[3-[4-(naphthalen-2-ylmethoxy)phenyl]phenyl]methylideneamino]oxyacetic acid (PubChem CID 91326292) has the molecular formula C26H21NO4 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[[3-[4-(naphthalen-2-ylmethoxy)phenyl]phenyl]methylideneamino]oxyacetic acid.
| Compound Name | 2-[[3-[4-(naphthalen-2-ylmethoxy)phenyl]phenyl]methylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 91326292 |
| Molecular Formula | C26H21NO4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[[3-[4-(naphthalen-2-ylmethoxy)phenyl]phenyl]methylideneamino]oxyacetic acid |
| SMILES | O=C(O)CON=Cc1cccc(-c2ccc(OCc3ccc4ccccc4c3)cc2)c1 |
| InChI | InChI=1S/C26H21NO4/c28-26(29)18-31-27-16-19-4-3-7-24(14-19)22-10-12-25(13-11-22)30-17-20-8-9-21-5-1-2-6-23(21)15-20/h1-16H,17-18H2,(H,28,29) |
| InChIKey | GIVSPHNCYZBWQL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|