C8H4N6O2 — CID 57455385
4-nitrotetrazolo[1,5-a][1,7]naphthyridine (PubChem CID 57455385) has the molecular formula C8H4N6O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is 4-nitrotetrazolo[1,5-a][1,7]naphthyridine.
| Compound Name | 4-nitrotetrazolo[1,5-a][1,7]naphthyridine |
|---|---|
| PubChem CID | 57455385 |
| Molecular Formula | C8H4N6O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-nitrotetrazolo[1,5-a][1,7]naphthyridine |
| SMILES | O=[N+]([O-])c1cc2ccncc2n2nnnc12 |
| InChI | InChI=1S/C8H4N6O2/c15-14(16)6-3-5-1-2-9-4-7(5)13-8(6)10-11-12-13/h1-4H |
| InChIKey | QMTOJARFWRILNR-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 99.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|