C23H27N9O4 — CID 101485459
6,8-dinitro-5-(2,4,6-tripyrrolidin-1-ylphenyl)tetrazolo[1,5-a]pyridine (PubChem CID 101485459) has the molecular formula C23H27N9O4 and a molecular weight of 493.53 g/mol. Its IUPAC name is 6,8-dinitro-5-(2,4,6-tripyrrolidin-1-ylphenyl)tetrazolo[1,5-a]pyridine.
| Compound Name | 6,8-dinitro-5-(2,4,6-tripyrrolidin-1-ylphenyl)tetrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 101485459 |
| Molecular Formula | C23H27N9O4 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 6,8-dinitro-5-(2,4,6-tripyrrolidin-1-ylphenyl)tetrazolo[1,5-a]pyridine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2nnnn2c1-c1c(N2CCCC2)cc(N2CCCC2)cc1N1CCCC1 |
| InChI | InChI=1S/C23H27N9O4/c33-31(34)19-15-20(32(35)36)23-24-25-26-30(23)22(19)21-17(28-9-3-4-10-28)13-16(27-7-1-2-8-27)14-18(21)29-11-5-6-12-29/h13-15H,1-12H2 |
| InChIKey | MUKXPEUBWFEBQB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 139.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|