C28H28FN3O2 — CID 57455477
6-[(3-fluoroazetidin-1-yl)methyl]-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one (PubChem CID 57455477) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is 6-[(3-fluoroazetidin-1-yl)methyl]-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one.
| Compound Name | 6-[(3-fluoroazetidin-1-yl)methyl]-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one |
|---|---|
| PubChem CID | 57455477 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 6-[(3-fluoroazetidin-1-yl)methyl]-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one |
| SMILES | O=c1[nH]ccc2cc(CN3CC(F)C3)c3ccc(-c4ccc(CN5CCOCC5)cc4)cc3c12 |
| InChI | InChI=1S/C28H28FN3O2/c29-24-17-32(18-24)16-23-13-22-7-8-30-28(33)27(22)26-14-21(5-6-25(23)26)20-3-1-19(2-4-20)15-31-9-11-34-12-10-31/h1-8,13-14,24H,9-12,15-18H2,(H,30,33) |
| InChIKey | GAMZXTHILNERGR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|