C31H28N2O4 — CID 57455500
6-(hydroxymethyl)-4-(2-hydroxyphenyl)-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one (PubChem CID 57455500) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4-(2-hydroxyphenyl)-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one.
| Compound Name | 6-(hydroxymethyl)-4-(2-hydroxyphenyl)-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one |
|---|---|
| PubChem CID | 57455500 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 6-(hydroxymethyl)-4-(2-hydroxyphenyl)-9-[4-(morpholin-4-ylmethyl)phenyl]-2H-benzo[h]isoquinolin-1-one |
| SMILES | O=c1[nH]cc(-c2ccccc2O)c2cc(CO)c3ccc(-c4ccc(CN5CCOCC5)cc4)cc3c12 |
| InChI | InChI=1S/C31H28N2O4/c34-19-23-16-27-28(25-3-1-2-4-29(25)35)17-32-31(36)30(27)26-15-22(9-10-24(23)26)21-7-5-20(6-8-21)18-33-11-13-37-14-12-33/h1-10,15-17,34-35H,11-14,18-19H2,(H,32,36) |
| InChIKey | UNUOJSKDBVYRRM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|