C10H14F3N2O2+ — CID 57466197
(1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,2-trifluoroacetate (PubChem CID 57466197) has the molecular formula C10H14F3N2O2+ and a molecular weight of 251.23 g/mol. Its IUPAC name is (1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,2-trifluoroacetate.
| Compound Name | (1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57466197 |
| Molecular Formula | C10H14F3N2O2+ |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (1-butyl-3-methylimidazol-3-ium-2-yl) 2,2,2-trifluoroacetate |
| SMILES | CCCCn1cc[n+](C)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N2O2/c1-3-4-5-15-7-6-14(2)9(15)17-8(16)10(11,12)13/h6-7H,3-5H2,1-2H3/q+1 |
| InChIKey | RPNLUUMISWLWNB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|