C23H22N7O2+ — CID 57466472
4-amino-1-cyclopropyl-N-[4-(phenylcarbamoylamino)phenyl]imidazo[1,5-a]pyrazin-4-ium-3-carboxamide (PubChem CID 57466472) has the molecular formula C23H22N7O2+ and a molecular weight of 428.48 g/mol. Its IUPAC name is 4-amino-1-cyclopropyl-N-[4-(phenylcarbamoylamino)phenyl]imidazo[1,5-a]pyrazin-4-ium-3-carboxamide.
| Compound Name | 4-amino-1-cyclopropyl-N-[4-(phenylcarbamoylamino)phenyl]imidazo[1,5-a]pyrazin-4-ium-3-carboxamide |
|---|---|
| PubChem CID | 57466472 |
| Molecular Formula | C23H22N7O2+ |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 4-amino-1-cyclopropyl-N-[4-(phenylcarbamoylamino)phenyl]imidazo[1,5-a]pyrazin-4-ium-3-carboxamide |
| SMILES | N[N+]12C=CN=CC1=C(C1CC1)N=C2C(=O)Nc1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N7O2/c24-30-13-12-25-14-19(30)20(15-6-7-15)29-21(30)22(31)26-17-8-10-18(11-9-17)28-23(32)27-16-4-2-1-3-5-16/h1-5,8-15H,6-7,24H2,(H2-,25,26,27,28,29,31,32)/p+1 |
| InChIKey | RIFSCFXGORKQCZ-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 120.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|